About N-[diethylaminosulfanyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide
N-[diethylaminosulfanyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide (PubChem CID 42630992) has the molecular formula C19H18F5N3O3S
and a molecular weight of 463.43 g/mol. Its IUPAC name is N-[diethylaminosulfanyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | N-[diethylaminosulfanyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide |
| PubChem CID | 42630992 |
| Molecular Formula | C19H18F5N3O3S |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | N-[diethylaminosulfanyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide |
| SMILES | CCN(CC)SN(C(=O)NC(=O)c1c(F)cccc1F)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F5N3O3S/c1-3-26(4-2)31-27(12-8-10-13(11-9-12)30-19(22,23)24)18(29)25-17(28)16-14(20)6-5-7-15(16)21/h5-11H,3-4H2,1-2H3,(H,25,28,29) |
| InChIKey | IDZOZWFKBKXENY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[diethylaminosulfanyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[diethylaminosulfanyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide?
The IUPAC name of N-[diethylaminosulfanyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide (CID 42630992) is N-[diethylaminosulfanyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide.
What is the SMILES notation for N-[diethylaminosulfanyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide?
The canonical SMILES for N-[diethylaminosulfanyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide is CCN(CC)SN(C(=O)NC(=O)c1c(F)cccc1F)c1ccc(OC(F)(F)F)cc1.
What is the InChIKey of N-[diethylaminosulfanyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide?
The InChIKey is IDZOZWFKBKXENY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18F5N3O3S/c1-3-26(4-2)31-27(12-8-10-13(11-9-12)30-19(22,23)24)18(29)25-17(28)16-14(20)6-5-7-15(16)21/h5-11H,3-4H2,1-2H3,(H,25,28,29).
What are the key properties of N-[diethylaminosulfanyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide?
N-[diethylaminosulfanyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide has a molecular weight of 463.43 g/mol, XLogP of 5.12, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[diethylaminosulfanyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide is sourced from PubChem (CID 42630992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).