About (4R)-4-hept-6-enyl-2,2-dimethyl-1,3-dioxolane
(4R)-4-hept-6-enyl-2,2-dimethyl-1,3-dioxolane (PubChem CID 42631026) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is (4R)-4-hept-6-enyl-2,2-dimethyl-1,3-dioxolane.
Molecular Properties
| Compound Name | (4R)-4-hept-6-enyl-2,2-dimethyl-1,3-dioxolane |
| PubChem CID | 42631026 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (4R)-4-hept-6-enyl-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=CCCCCC[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H22O2/c1-4-5-6-7-8-9-11-10-13-12(2,3)14-11/h4,11H,1,5-10H2,2-3H3/t11-/m1/s1 |
| InChIKey | FOCPFBLGXLZXPH-LLVKDONJSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-hept-6-enyl-2,2-dimethyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-hept-6-enyl-2,2-dimethyl-1,3-dioxolane?
The IUPAC name of (4R)-4-hept-6-enyl-2,2-dimethyl-1,3-dioxolane (CID 42631026) is (4R)-4-hept-6-enyl-2,2-dimethyl-1,3-dioxolane.
What is the SMILES notation for (4R)-4-hept-6-enyl-2,2-dimethyl-1,3-dioxolane?
The canonical SMILES for (4R)-4-hept-6-enyl-2,2-dimethyl-1,3-dioxolane is C=CCCCCC[C@@H]1COC(C)(C)O1.
What is the InChIKey of (4R)-4-hept-6-enyl-2,2-dimethyl-1,3-dioxolane?
The InChIKey is FOCPFBLGXLZXPH-LLVKDONJSA-N. The full InChI is InChI=1S/C12H22O2/c1-4-5-6-7-8-9-11-10-13-12(2,3)14-11/h4,11H,1,5-10H2,2-3H3/t11-/m1/s1.
What are the key properties of (4R)-4-hept-6-enyl-2,2-dimethyl-1,3-dioxolane?
(4R)-4-hept-6-enyl-2,2-dimethyl-1,3-dioxolane has a molecular weight of 198.31 g/mol, XLogP of 3.27, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-hept-6-enyl-2,2-dimethyl-1,3-dioxolane is sourced from PubChem (CID 42631026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).