About 4,9-dimethoxy-5-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one
4,9-dimethoxy-5-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one (PubChem CID 42631145) has the molecular formula C23H22O7
and a molecular weight of 410.42 g/mol. Its IUPAC name is 4,9-dimethoxy-5-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one.
Molecular Properties
| Compound Name | 4,9-dimethoxy-5-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one |
| PubChem CID | 42631145 |
| Molecular Formula | C23H22O7 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 4,9-dimethoxy-5-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one |
| SMILES | COc1c2occc2c(OC)c2c(OCCCCOc3ccccc3)cc(=O)oc12 |
| InChI | InChI=1S/C23H22O7/c1-25-20-16-10-13-29-21(16)23(26-2)22-19(20)17(14-18(24)30-22)28-12-7-6-11-27-15-8-4-3-5-9-15/h3-5,8-10,13-14H,6-7,11-12H2,1-2H3 |
| InChIKey | YJSFGKLFCJHZPF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4,9-dimethoxy-5-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-dimethoxy-5-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one?
The IUPAC name of 4,9-dimethoxy-5-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one (CID 42631145) is 4,9-dimethoxy-5-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one.
What is the SMILES notation for 4,9-dimethoxy-5-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one?
The canonical SMILES for 4,9-dimethoxy-5-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one is COc1c2occc2c(OC)c2c(OCCCCOc3ccccc3)cc(=O)oc12.
What is the InChIKey of 4,9-dimethoxy-5-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one?
The InChIKey is YJSFGKLFCJHZPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O7/c1-25-20-16-10-13-29-21(16)23(26-2)22-19(20)17(14-18(24)30-22)28-12-7-6-11-27-15-8-4-3-5-9-15/h3-5,8-10,13-14H,6-7,11-12H2,1-2H3.
What are the key properties of 4,9-dimethoxy-5-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one?
4,9-dimethoxy-5-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one has a molecular weight of 410.42 g/mol, XLogP of 4.79, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-dimethoxy-5-(4-phenoxybutoxy)furo[3,2-g]chromen-7-one is sourced from PubChem (CID 42631145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).