C15H24O3 — CID 42631323
(4aS,9R,9aR)-9-hydroxy-6,6,9-trimethyl-2,4a,5,7,8,9a-hexahydro-1H-benzo[7]annulene-3-carboxylic acid (PubChem CID 42631323) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (4aS,9R,9aR)-9-hydroxy-6,6,9-trimethyl-2,4a,5,7,8,9a-hexahydro-1H-benzo[7]annulene-3-carboxylic acid.
| Compound Name | (4aS,9R,9aR)-9-hydroxy-6,6,9-trimethyl-2,4a,5,7,8,9a-hexahydro-1H-benzo[7]annulene-3-carboxylic acid |
|---|---|
| PubChem CID | 42631323 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (4aS,9R,9aR)-9-hydroxy-6,6,9-trimethyl-2,4a,5,7,8,9a-hexahydro-1H-benzo[7]annulene-3-carboxylic acid |
| SMILES | CC1(C)CC[C@@](C)(O)[C@@H]2CCC(C(=O)O)=C[C@@H]2C1 |
| InChI | InChI=1S/C15H24O3/c1-14(2)6-7-15(3,18)12-5-4-10(13(16)17)8-11(12)9-14/h8,11-12,18H,4-7,9H2,1-3H3,(H,16,17)/t11-,12-,15-/m1/s1 |
| InChIKey | FCCZNLPVQDZELH-LALPHHSUSA-N |
| XLogP | 2.98 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |