About 3-[(2R,5R)-3-methylidene-5-(trityloxymethyl)oxolan-2-yl]propan-1-ol
3-[(2R,5R)-3-methylidene-5-(trityloxymethyl)oxolan-2-yl]propan-1-ol (PubChem CID 42631565) has the molecular formula C28H30O3
and a molecular weight of 414.55 g/mol. Its IUPAC name is 3-[(2R,5R)-3-methylidene-5-(trityloxymethyl)oxolan-2-yl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(2R,5R)-3-methylidene-5-(trityloxymethyl)oxolan-2-yl]propan-1-ol |
| PubChem CID | 42631565 |
| Molecular Formula | C28H30O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 3-[(2R,5R)-3-methylidene-5-(trityloxymethyl)oxolan-2-yl]propan-1-ol |
| SMILES | C=C1C[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@@H]1CCCO |
| InChI | InChI=1S/C28H30O3/c1-22-20-26(31-27(22)18-11-19-29)21-30-28(23-12-5-2-6-13-23,24-14-7-3-8-15-24)25-16-9-4-10-17-25/h2-10,12-17,26-27,29H,1,11,18-21H2/t26-,27-/m1/s1 |
| InChIKey | QYNVBXQTYMVUNC-KAYWLYCHSA-N |
| XLogP | 5.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2R,5R)-3-methylidene-5-(trityloxymethyl)oxolan-2-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2R,5R)-3-methylidene-5-(trityloxymethyl)oxolan-2-yl]propan-1-ol?
The IUPAC name of 3-[(2R,5R)-3-methylidene-5-(trityloxymethyl)oxolan-2-yl]propan-1-ol (CID 42631565) is 3-[(2R,5R)-3-methylidene-5-(trityloxymethyl)oxolan-2-yl]propan-1-ol.
What is the SMILES notation for 3-[(2R,5R)-3-methylidene-5-(trityloxymethyl)oxolan-2-yl]propan-1-ol?
The canonical SMILES for 3-[(2R,5R)-3-methylidene-5-(trityloxymethyl)oxolan-2-yl]propan-1-ol is C=C1C[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@@H]1CCCO.
What is the InChIKey of 3-[(2R,5R)-3-methylidene-5-(trityloxymethyl)oxolan-2-yl]propan-1-ol?
The InChIKey is QYNVBXQTYMVUNC-KAYWLYCHSA-N. The full InChI is InChI=1S/C28H30O3/c1-22-20-26(31-27(22)18-11-19-29)21-30-28(23-12-5-2-6-13-23,24-14-7-3-8-15-24)25-16-9-4-10-17-25/h2-10,12-17,26-27,29H,1,11,18-21H2/t26-,27-/m1/s1.
What are the key properties of 3-[(2R,5R)-3-methylidene-5-(trityloxymethyl)oxolan-2-yl]propan-1-ol?
3-[(2R,5R)-3-methylidene-5-(trityloxymethyl)oxolan-2-yl]propan-1-ol has a molecular weight of 414.55 g/mol, XLogP of 5.48, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2R,5R)-3-methylidene-5-(trityloxymethyl)oxolan-2-yl]propan-1-ol is sourced from PubChem (CID 42631565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).