About 4-(1-adamantyl)-N'-[(2S)-2-aminopropanoyl]quinoline-2-carbohydrazide
4-(1-adamantyl)-N'-[(2S)-2-aminopropanoyl]quinoline-2-carbohydrazide (PubChem CID 42631594) has the molecular formula C23H28N4O2
and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-(1-adamantyl)-N'-[(2S)-2-aminopropanoyl]quinoline-2-carbohydrazide.
Molecular Properties
| Compound Name | 4-(1-adamantyl)-N'-[(2S)-2-aminopropanoyl]quinoline-2-carbohydrazide |
| PubChem CID | 42631594 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 4-(1-adamantyl)-N'-[(2S)-2-aminopropanoyl]quinoline-2-carbohydrazide |
| SMILES | C[C@H](N)C(=O)NNC(=O)c1cc(C23CC4CC(CC(C4)C2)C3)c2ccccc2n1 |
| InChI | InChI=1S/C23H28N4O2/c1-13(24)21(28)26-27-22(29)20-9-18(17-4-2-3-5-19(17)25-20)23-10-14-6-15(11-23)8-16(7-14)12-23/h2-5,9,13-16H,6-8,10-12,24H2,1H3,(H,26,28)(H,27,29)/t13-,14?,15?,16?,23?/m0/s1 |
| InChIKey | WMWPWFNXFSPXTK-HDDXYUSQSA-N |
| XLogP | 2.81 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-adamantyl)-N'-[(2S)-2-aminopropanoyl]quinoline-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-adamantyl)-N'-[(2S)-2-aminopropanoyl]quinoline-2-carbohydrazide?
The IUPAC name of 4-(1-adamantyl)-N'-[(2S)-2-aminopropanoyl]quinoline-2-carbohydrazide (CID 42631594) is 4-(1-adamantyl)-N'-[(2S)-2-aminopropanoyl]quinoline-2-carbohydrazide.
What is the SMILES notation for 4-(1-adamantyl)-N'-[(2S)-2-aminopropanoyl]quinoline-2-carbohydrazide?
The canonical SMILES for 4-(1-adamantyl)-N'-[(2S)-2-aminopropanoyl]quinoline-2-carbohydrazide is C[C@H](N)C(=O)NNC(=O)c1cc(C23CC4CC(CC(C4)C2)C3)c2ccccc2n1.
What is the InChIKey of 4-(1-adamantyl)-N'-[(2S)-2-aminopropanoyl]quinoline-2-carbohydrazide?
The InChIKey is WMWPWFNXFSPXTK-HDDXYUSQSA-N. The full InChI is InChI=1S/C23H28N4O2/c1-13(24)21(28)26-27-22(29)20-9-18(17-4-2-3-5-19(17)25-20)23-10-14-6-15(11-23)8-16(7-14)12-23/h2-5,9,13-16H,6-8,10-12,24H2,1H3,(H,26,28)(H,27,29)/t13-,14?,15?,16?,23?/m0/s1.
What are the key properties of 4-(1-adamantyl)-N'-[(2S)-2-aminopropanoyl]quinoline-2-carbohydrazide?
4-(1-adamantyl)-N'-[(2S)-2-aminopropanoyl]quinoline-2-carbohydrazide has a molecular weight of 392.50 g/mol, XLogP of 2.81, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-adamantyl)-N'-[(2S)-2-aminopropanoyl]quinoline-2-carbohydrazide is sourced from PubChem (CID 42631594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).