C26H40O5Si — CID 42631875
[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-[(2S,3S)-3-[(1R)-1-hydroxy-2-methylidenehex-4-ynyl]oxiran-2-yl]pent-4-en-2-yl] hex-4-ynoate (PubChem CID 42631875) has the molecular formula C26H40O5Si and a molecular weight of 460.69 g/mol. Its IUPAC name is [(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-[(2S,3S)-3-[(1R)-1-hydroxy-2-methylidenehex-4-ynyl]oxiran-2-yl]pent-4-en-2-yl] hex-4-ynoate.
| Compound Name | [(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-[(2S,3S)-3-[(1R)-1-hydroxy-2-methylidenehex-4-ynyl]oxiran-2-yl]pent-4-en-2-yl] hex-4-ynoate |
|---|---|
| PubChem CID | 42631875 |
| Molecular Formula | C26H40O5Si |
| Molecular Weight | 460.69 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | [(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-[(2S,3S)-3-[(1R)-1-hydroxy-2-methylidenehex-4-ynyl]oxiran-2-yl]pent-4-en-2-yl] hex-4-ynoate |
| SMILES | C=C(CC#CC)[C@@H](O)[C@@H]1O[C@H]1C(=C)C[C@H](CO[Si](C)(C)C(C)(C)C)OC(=O)CCC#CC |
| InChI | InChI=1S/C26H40O5Si/c1-10-12-14-16-22(27)30-21(18-29-32(8,9)26(5,6)7)17-20(4)24-25(31-24)23(28)19(3)15-13-11-2/h21,23-25,28H,3-4,14-18H2,1-2,5-9H3/t21-,23-,24+,25+/m1/s1 |
| InChIKey | MUABRPOBBJRLFJ-VGCGRUFVSA-N |
| XLogP | 4.77 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.69 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|