C32H54O5Si2 — CID 42631876
[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-[(2S,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylidenehex-4-ynyl]oxiran-2-yl]pent-4-en-2-yl] hex-4-ynoate (PubChem CID 42631876) has the molecular formula C32H54O5Si2 and a molecular weight of 574.95 g/mol. Its IUPAC name is [(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-[(2S,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylidenehex-4-ynyl]oxiran-2-yl]pent-4-en-2-yl] hex-4-ynoate.
| Compound Name | [(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-[(2S,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylidenehex-4-ynyl]oxiran-2-yl]pent-4-en-2-yl] hex-4-ynoate |
|---|---|
| PubChem CID | 42631876 |
| Molecular Formula | C32H54O5Si2 |
| Molecular Weight | 574.95 g/mol |
| Exact Mass | 574.35 |
| IUPAC Name | [(2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-[(2S,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylidenehex-4-ynyl]oxiran-2-yl]pent-4-en-2-yl] hex-4-ynoate |
| SMILES | C=C(CC#CC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1C(=C)C[C@H](CO[Si](C)(C)C(C)(C)C)OC(=O)CCC#CC |
| InChI | InChI=1S/C32H54O5Si2/c1-15-17-19-21-27(33)35-26(23-34-38(11,12)31(5,6)7)22-25(4)28-30(36-28)29(24(3)20-18-16-2)37-39(13,14)32(8,9)10/h26,28-30H,3-4,19-23H2,1-2,5-14H3/t26-,28+,29-,30-/m1/s1 |
| InChIKey | OKYIFHMXYRKTCV-RRFVUZEHSA-N |
| XLogP | 7.80 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.95 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|