C14H13N3O4S4 — CID 42632071
5-[[4-(4-methylphenyl)sulfonyl-1H-pyrrol-3-yl]sulfonylmethyl]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 42632071) has the molecular formula C14H13N3O4S4 and a molecular weight of 415.54 g/mol. Its IUPAC name is 5-[[4-(4-methylphenyl)sulfonyl-1H-pyrrol-3-yl]sulfonylmethyl]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[[4-(4-methylphenyl)sulfonyl-1H-pyrrol-3-yl]sulfonylmethyl]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 42632071 |
| Molecular Formula | C14H13N3O4S4 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | 5-[[4-(4-methylphenyl)sulfonyl-1H-pyrrol-3-yl]sulfonylmethyl]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | Cc1ccc(S(=O)(=O)c2c[nH]cc2S(=O)(=O)Cc2n[nH]c(=S)s2)cc1 |
| InChI | InChI=1S/C14H13N3O4S4/c1-9-2-4-10(5-3-9)25(20,21)12-7-15-6-11(12)24(18,19)8-13-16-17-14(22)23-13/h2-7,15H,8H2,1H3,(H,17,22) |
| InChIKey | TWNLYLPYUWJYHY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 112.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|