C12H16BrNO3 — CID 42632086
ethyl 9-bromo-4,5,6,7,8,9-hexahydrocycloocta[c][1,2]oxazole-3-carboxylate (PubChem CID 42632086) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is ethyl 9-bromo-4,5,6,7,8,9-hexahydrocycloocta[c][1,2]oxazole-3-carboxylate.
| Compound Name | ethyl 9-bromo-4,5,6,7,8,9-hexahydrocycloocta[c][1,2]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 42632086 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | ethyl 9-bromo-4,5,6,7,8,9-hexahydrocycloocta[c][1,2]oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1onc2c1CCCCCC2Br |
| InChI | InChI=1S/C12H16BrNO3/c1-2-16-12(15)11-8-6-4-3-5-7-9(13)10(8)14-17-11/h9H,2-7H2,1H3 |
| InChIKey | NUCMANHXACCMMG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|