C15H30O6S — CID 42632238
(2S,3S,4S,5R)-2-decylsulfonyl-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 42632238) has the molecular formula C15H30O6S and a molecular weight of 338.47 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-decylsulfonyl-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4S,5R)-2-decylsulfonyl-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 42632238 |
| Molecular Formula | C15H30O6S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (2S,3S,4S,5R)-2-decylsulfonyl-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCCCCCCCCCS(=O)(=O)[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H30O6S/c1-2-3-4-5-6-7-8-9-10-22(19,20)15-14(18)13(17)12(11-16)21-15/h12-18H,2-11H2,1H3/t12-,13-,14+,15+/m1/s1 |
| InChIKey | SFIOCPRSJGLZLG-KBXIAJHMSA-N |
| XLogP | 0.98 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|