C5H12ClF3N2O — CID 42632351
(2S,3S)-4,4,4-trifluoro-2-hydrazinyl-3-methylbutan-1-ol;hydrochloride (PubChem CID 42632351) has the molecular formula C5H12ClF3N2O and a molecular weight of 208.61 g/mol. Its IUPAC name is (2S,3S)-4,4,4-trifluoro-2-hydrazinyl-3-methylbutan-1-ol;hydrochloride.
| Compound Name | (2S,3S)-4,4,4-trifluoro-2-hydrazinyl-3-methylbutan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 42632351 |
| Molecular Formula | C5H12ClF3N2O |
| Molecular Weight | 208.61 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | (2S,3S)-4,4,4-trifluoro-2-hydrazinyl-3-methylbutan-1-ol;hydrochloride |
| SMILES | C[C@@H]([C@@H](CO)NN)C(F)(F)F.Cl |
| InChI | InChI=1S/C5H11F3N2O.ClH/c1-3(5(6,7)8)4(2-11)10-9;/h3-4,10-11H,2,9H2,1H3;1H/t3-,4+;/m0./s1 |
| InChIKey | GSQPUIKXFCONPJ-RFKZQXLXSA-N |
| XLogP | 0.43 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.61 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|