C20H16N2O3 — CID 42632427
10,10-dimethyl-9-oxa-14,21-diazatetracyclo[11.8.0.02,7.015,20]henicosa-1(21),2,4,6,13,15,17,19-octaene-8,12-dione (PubChem CID 42632427) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 10,10-dimethyl-9-oxa-14,21-diazatetracyclo[11.8.0.02,7.015,20]henicosa-1(21),2,4,6,13,15,17,19-octaene-8,12-dione.
| Compound Name | 10,10-dimethyl-9-oxa-14,21-diazatetracyclo[11.8.0.02,7.015,20]henicosa-1(21),2,4,6,13,15,17,19-octaene-8,12-dione |
|---|---|
| PubChem CID | 42632427 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 10,10-dimethyl-9-oxa-14,21-diazatetracyclo[11.8.0.02,7.015,20]henicosa-1(21),2,4,6,13,15,17,19-octaene-8,12-dione |
| SMILES | CC1(C)CC(=O)c2nc3ccccc3nc2-c2ccccc2C(=O)O1 |
| InChI | InChI=1S/C20H16N2O3/c1-20(2)11-16(23)18-17(21-14-9-5-6-10-15(14)22-18)12-7-3-4-8-13(12)19(24)25-20/h3-10H,11H2,1-2H3 |
| InChIKey | FKVHNIDETFYCSU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |