C23H23F6NO — CID 42632467
(2S,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenyl-1-prop-2-enylpiperidine (PubChem CID 42632467) has the molecular formula C23H23F6NO and a molecular weight of 443.43 g/mol. Its IUPAC name is (2S,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenyl-1-prop-2-enylpiperidine.
| Compound Name | (2S,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenyl-1-prop-2-enylpiperidine |
|---|---|
| PubChem CID | 42632467 |
| Molecular Formula | C23H23F6NO |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | (2S,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenyl-1-prop-2-enylpiperidine |
| SMILES | C=CCN1CCC[C@H](OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1c1ccccc1 |
| InChI | InChI=1S/C23H23F6NO/c1-2-10-30-11-6-9-20(21(30)17-7-4-3-5-8-17)31-15-16-12-18(22(24,25)26)14-19(13-16)23(27,28)29/h2-5,7-8,12-14,20-21H,1,6,9-11,15H2/t20-,21?/m0/s1 |
| InChIKey | UIXVNAKUCCOCBX-BGERDNNASA-N |
| XLogP | 6.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|