C18H20N4O — CID 42633428
[4-[3-(1H-pyrazolo[3,4-b]pyridin-4-yl)phenyl]oxan-4-yl]methanamine (PubChem CID 42633428) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is [4-[3-(1H-pyrazolo[3,4-b]pyridin-4-yl)phenyl]oxan-4-yl]methanamine.
| Compound Name | [4-[3-(1H-pyrazolo[3,4-b]pyridin-4-yl)phenyl]oxan-4-yl]methanamine |
|---|---|
| PubChem CID | 42633428 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [4-[3-(1H-pyrazolo[3,4-b]pyridin-4-yl)phenyl]oxan-4-yl]methanamine |
| SMILES | NCC1(c2cccc(-c3ccnc4[nH]ncc34)c2)CCOCC1 |
| InChI | InChI=1S/C18H20N4O/c19-12-18(5-8-23-9-6-18)14-3-1-2-13(10-14)15-4-7-20-17-16(15)11-21-22-17/h1-4,7,10-11H,5-6,8-9,12,19H2,(H,20,21,22) |
| InChIKey | GVHXPJZZHRXUIL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |