C22H15F3N6O3 — CID 42633495
2-[2-[4-[4-(trifluoromethoxy)anilino]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 42633495) has the molecular formula C22H15F3N6O3 and a molecular weight of 468.40 g/mol. Its IUPAC name is 2-[2-[4-[4-(trifluoromethoxy)anilino]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-[4-(trifluoromethoxy)anilino]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42633495 |
| Molecular Formula | C22H15F3N6O3 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 2-[2-[4-[4-(trifluoromethoxy)anilino]pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCn1ncc2c(Nc3ccc(OC(F)(F)F)cc3)ncnc21 |
| InChI | InChI=1S/C22H15F3N6O3/c23-22(24,25)34-14-7-5-13(6-8-14)29-18-17-11-28-31(19(17)27-12-26-18)10-9-30-20(32)15-3-1-2-4-16(15)21(30)33/h1-8,11-12H,9-10H2,(H,26,27,29) |
| InChIKey | LJLWZMUURKOAFD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|