About morpholin-3-ylmethyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate
morpholin-3-ylmethyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate (PubChem CID 42634521) has the molecular formula C16H21F2N3O3
and a molecular weight of 341.36 g/mol. Its IUPAC name is morpholin-3-ylmethyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | morpholin-3-ylmethyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate |
| PubChem CID | 42634521 |
| Molecular Formula | C16H21F2N3O3 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | morpholin-3-ylmethyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate |
| SMILES | O=C(OCC1COCCN1)N1CCN(c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C16H21F2N3O3/c17-12-1-2-15(14(18)9-12)20-4-6-21(7-5-20)16(22)24-11-13-10-23-8-3-19-13/h1-2,9,13,19H,3-8,10-11H2 |
| InChIKey | FYMLVXCJPKAAIY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze morpholin-3-ylmethyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-3-ylmethyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate?
The IUPAC name of morpholin-3-ylmethyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate (CID 42634521) is morpholin-3-ylmethyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate.
What is the SMILES notation for morpholin-3-ylmethyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate?
The canonical SMILES for morpholin-3-ylmethyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate is O=C(OCC1COCCN1)N1CCN(c2ccc(F)cc2F)CC1.
What is the InChIKey of morpholin-3-ylmethyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate?
The InChIKey is FYMLVXCJPKAAIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F2N3O3/c17-12-1-2-15(14(18)9-12)20-4-6-21(7-5-20)16(22)24-11-13-10-23-8-3-19-13/h1-2,9,13,19H,3-8,10-11H2.
What are the key properties of morpholin-3-ylmethyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate?
morpholin-3-ylmethyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate has a molecular weight of 341.36 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-3-ylmethyl 4-(2,4-difluorophenyl)piperazine-1-carboxylate is sourced from PubChem (CID 42634521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).