About [4-(1,3-dioxoisoindol-2-yl)phenyl]methyl nitrate
[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl nitrate (PubChem CID 42634898) has the molecular formula C15H10N2O5
and a molecular weight of 298.25 g/mol. Its IUPAC name is [4-(1,3-dioxoisoindol-2-yl)phenyl]methyl nitrate.
Molecular Properties
| Compound Name | [4-(1,3-dioxoisoindol-2-yl)phenyl]methyl nitrate |
| PubChem CID | 42634898 |
| Molecular Formula | C15H10N2O5 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | [4-(1,3-dioxoisoindol-2-yl)phenyl]methyl nitrate |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc(CO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H10N2O5/c18-14-12-3-1-2-4-13(12)15(19)16(14)11-7-5-10(6-8-11)9-22-17(20)21/h1-8H,9H2 |
| InChIKey | UCGBYDOUJFRVEN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [4-(1,3-dioxoisoindol-2-yl)phenyl]methyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,3-dioxoisoindol-2-yl)phenyl]methyl nitrate?
The IUPAC name of [4-(1,3-dioxoisoindol-2-yl)phenyl]methyl nitrate (CID 42634898) is [4-(1,3-dioxoisoindol-2-yl)phenyl]methyl nitrate.
What is the SMILES notation for [4-(1,3-dioxoisoindol-2-yl)phenyl]methyl nitrate?
The canonical SMILES for [4-(1,3-dioxoisoindol-2-yl)phenyl]methyl nitrate is O=C1c2ccccc2C(=O)N1c1ccc(CO[N+](=O)[O-])cc1.
What is the InChIKey of [4-(1,3-dioxoisoindol-2-yl)phenyl]methyl nitrate?
The InChIKey is UCGBYDOUJFRVEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O5/c18-14-12-3-1-2-4-13(12)15(19)16(14)11-7-5-10(6-8-11)9-22-17(20)21/h1-8H,9H2.
What are the key properties of [4-(1,3-dioxoisoindol-2-yl)phenyl]methyl nitrate?
[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl nitrate has a molecular weight of 298.25 g/mol, XLogP of 2.20, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,3-dioxoisoindol-2-yl)phenyl]methyl nitrate is sourced from PubChem (CID 42634898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).