C22H26ClN7O2S — CID 42635156
N-[2-chloro-6-(trideuteriomethyl)phenyl]-2-[[2-methyl-6-[2,2,3,3,5,5,6,6-octadeuterio-4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 42635156) has the molecular formula C22H26ClN7O2S and a molecular weight of 499.08 g/mol. Its IUPAC name is N-[2-chloro-6-(trideuteriomethyl)phenyl]-2-[[2-methyl-6-[2,2,3,3,5,5,6,6-octadeuterio-4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-chloro-6-(trideuteriomethyl)phenyl]-2-[[2-methyl-6-[2,2,3,3,5,5,6,6-octadeuterio-4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 42635156 |
| Molecular Formula | C22H26ClN7O2S |
| Molecular Weight | 499.08 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | N-[2-chloro-6-(trideuteriomethyl)phenyl]-2-[[2-methyl-6-[2,2,3,3,5,5,6,6-octadeuterio-4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | [2H]C([2H])([2H])c1cccc(Cl)c1NC(=O)c1cnc(Nc2cc(N3C([2H])([2H])C([2H])([2H])N(CCO)C([2H])([2H])C3([2H])[2H])nc(C)n2)s1 |
| InChI | InChI=1S/C22H26ClN7O2S/c1-14-4-3-5-16(23)20(14)28-21(32)17-13-24-22(33-17)27-18-12-19(26-15(2)25-18)30-8-6-29(7-9-30)10-11-31/h3-5,12-13,31H,6-11H2,1-2H3,(H,28,32)(H,24,25,26,27)/i1D3,6D2,7D2,8D2,9D2 |
| InChIKey | ZBNZXTGUTAYRHI-JJTGTYJFSA-N |
| XLogP | 3.31 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.08 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |