About indol-2-ylidenecyanamide
indol-2-ylidenecyanamide (PubChem CID 42635632) has the molecular formula C9H5N3
and a molecular weight of 155.16 g/mol. Its IUPAC name is indol-2-ylidenecyanamide.
Molecular Properties
| Compound Name | indol-2-ylidenecyanamide |
| PubChem CID | 42635632 |
| Molecular Formula | C9H5N3 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | indol-2-ylidenecyanamide |
| SMILES | N#C/N=C1/C=c2ccccc2=N1 |
| InChI | InChI=1S/C9H5N3/c10-6-11-9-5-7-3-1-2-4-8(7)12-9/h1-5H/b11-9- |
| InChIKey | DVCSDZOVVLLAKL-LUAWRHEFSA-N |
| XLogP | -0.02 |
| TPSA | 48.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze indol-2-ylidenecyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indol-2-ylidenecyanamide?
The IUPAC name of indol-2-ylidenecyanamide (CID 42635632) is indol-2-ylidenecyanamide.
What is the SMILES notation for indol-2-ylidenecyanamide?
The canonical SMILES for indol-2-ylidenecyanamide is N#C/N=C1/C=c2ccccc2=N1.
What is the InChIKey of indol-2-ylidenecyanamide?
The InChIKey is DVCSDZOVVLLAKL-LUAWRHEFSA-N. The full InChI is InChI=1S/C9H5N3/c10-6-11-9-5-7-3-1-2-4-8(7)12-9/h1-5H/b11-9-.
What are the key properties of indol-2-ylidenecyanamide?
indol-2-ylidenecyanamide has a molecular weight of 155.16 g/mol, XLogP of -0.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indol-2-ylidenecyanamide is sourced from PubChem (CID 42635632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).