About 2,3-dibromo-1,1-diethoxypropane
2,3-dibromo-1,1-diethoxypropane (PubChem CID 4263567) has the molecular formula C7H14Br2O2
and a molecular weight of 290.00 g/mol. Its IUPAC name is 2,3-dibromo-1,1-diethoxypropane.
Molecular Properties
| Compound Name | 2,3-dibromo-1,1-diethoxypropane |
| PubChem CID | 4263567 |
| Molecular Formula | C7H14Br2O2 |
| Molecular Weight | 290.00 g/mol |
| Exact Mass | 287.94 |
| IUPAC Name | 2,3-dibromo-1,1-diethoxypropane |
| SMILES | CCOC(OCC)C(Br)CBr |
| InChI | InChI=1S/C7H14Br2O2/c1-3-10-7(11-4-2)6(9)5-8/h6-7H,3-5H2,1-2H3 |
| InChIKey | DVTLFBDHZBBAET-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.00 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dibromo-1,1-diethoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromo-1,1-diethoxypropane?
The IUPAC name of 2,3-dibromo-1,1-diethoxypropane (CID 4263567) is 2,3-dibromo-1,1-diethoxypropane.
What is the SMILES notation for 2,3-dibromo-1,1-diethoxypropane?
The canonical SMILES for 2,3-dibromo-1,1-diethoxypropane is CCOC(OCC)C(Br)CBr.
What is the InChIKey of 2,3-dibromo-1,1-diethoxypropane?
The InChIKey is DVTLFBDHZBBAET-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14Br2O2/c1-3-10-7(11-4-2)6(9)5-8/h6-7H,3-5H2,1-2H3.
What are the key properties of 2,3-dibromo-1,1-diethoxypropane?
2,3-dibromo-1,1-diethoxypropane has a molecular weight of 290.00 g/mol, XLogP of 2.54, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromo-1,1-diethoxypropane is sourced from PubChem (CID 4263567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).