C23H19ClF2N2O3 — CID 42635819
(6-chloro-3-pyridinyl)-[1-(2,3-difluorophenyl)-6,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 42635819) has the molecular formula C23H19ClF2N2O3 and a molecular weight of 444.87 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)-[1-(2,3-difluorophenyl)-6,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | (6-chloro-3-pyridinyl)-[1-(2,3-difluorophenyl)-6,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 42635819 |
| Molecular Formula | C23H19ClF2N2O3 |
| Molecular Weight | 444.87 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | (6-chloro-3-pyridinyl)-[1-(2,3-difluorophenyl)-6,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | COc1cc2c(c(OC)c1)C(c1cccc(F)c1F)N(C(=O)c1ccc(Cl)nc1)CC2 |
| InChI | InChI=1S/C23H19ClF2N2O3/c1-30-15-10-13-8-9-28(23(29)14-6-7-19(24)27-12-14)22(20(13)18(11-15)31-2)16-4-3-5-17(25)21(16)26/h3-7,10-12,22H,8-9H2,1-2H3 |
| InChIKey | YPTDDHHRBMICDB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.87 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|