C19H18N2O5 — CID 42636180
1,3-dimethoxy-5-(2-methylphenyl)-5-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 42636180) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is 1,3-dimethoxy-5-(2-methylphenyl)-5-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethoxy-5-(2-methylphenyl)-5-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 42636180 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1,3-dimethoxy-5-(2-methylphenyl)-5-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CON1C(=O)N(OC)C(=O)C(c2ccccc2)(c2ccccc2C)C1=O |
| InChI | InChI=1S/C19H18N2O5/c1-13-9-7-8-12-15(13)19(14-10-5-4-6-11-14)16(22)20(25-2)18(24)21(26-3)17(19)23/h4-12H,1-3H3 |
| InChIKey | ZFEFVTOKOXICJY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|