About 2-fluoro-3-methylidene-1,2-dihydroindene
2-fluoro-3-methylidene-1,2-dihydroindene (PubChem CID 42636184) has the molecular formula C10H9F
and a molecular weight of 148.18 g/mol. Its IUPAC name is 2-fluoro-3-methylidene-1,2-dihydroindene.
Molecular Properties
| Compound Name | 2-fluoro-3-methylidene-1,2-dihydroindene |
| PubChem CID | 42636184 |
| Molecular Formula | C10H9F |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 2-fluoro-3-methylidene-1,2-dihydroindene |
| SMILES | C=C1c2ccccc2CC1F |
| InChI | InChI=1S/C10H9F/c1-7-9-5-3-2-4-8(9)6-10(7)11/h2-5,10H,1,6H2 |
| InChIKey | KUQDRYRAPGWOPB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-fluoro-3-methylidene-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-methylidene-1,2-dihydroindene?
The IUPAC name of 2-fluoro-3-methylidene-1,2-dihydroindene (CID 42636184) is 2-fluoro-3-methylidene-1,2-dihydroindene.
What is the SMILES notation for 2-fluoro-3-methylidene-1,2-dihydroindene?
The canonical SMILES for 2-fluoro-3-methylidene-1,2-dihydroindene is C=C1c2ccccc2CC1F.
What is the InChIKey of 2-fluoro-3-methylidene-1,2-dihydroindene?
The InChIKey is KUQDRYRAPGWOPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F/c1-7-9-5-3-2-4-8(9)6-10(7)11/h2-5,10H,1,6H2.
What are the key properties of 2-fluoro-3-methylidene-1,2-dihydroindene?
2-fluoro-3-methylidene-1,2-dihydroindene has a molecular weight of 148.18 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-methylidene-1,2-dihydroindene is sourced from PubChem (CID 42636184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).