C23H32O4 — CID 42636549
[(1R,2S,4R,5S,8S)-8-[(1S)-1,2-dihydroxyethyl]-4,5,8-trimethyl-9-methylidene-2-bicyclo[3.3.1]nonanyl] 4-methylbenzoate (PubChem CID 42636549) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is [(1R,2S,4R,5S,8S)-8-[(1S)-1,2-dihydroxyethyl]-4,5,8-trimethyl-9-methylidene-2-bicyclo[3.3.1]nonanyl] 4-methylbenzoate.
| Compound Name | [(1R,2S,4R,5S,8S)-8-[(1S)-1,2-dihydroxyethyl]-4,5,8-trimethyl-9-methylidene-2-bicyclo[3.3.1]nonanyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 42636549 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(1R,2S,4R,5S,8S)-8-[(1S)-1,2-dihydroxyethyl]-4,5,8-trimethyl-9-methylidene-2-bicyclo[3.3.1]nonanyl] 4-methylbenzoate |
| SMILES | C=C1[C@H]2[C@@H](OC(=O)c3ccc(C)cc3)C[C@@H](C)[C@]1(C)CC[C@]2(C)[C@H](O)CO |
| InChI | InChI=1S/C23H32O4/c1-14-6-8-17(9-7-14)21(26)27-18-12-15(2)22(4)10-11-23(5,19(25)13-24)20(18)16(22)3/h6-9,15,18-20,24-25H,3,10-13H2,1-2,4-5H3/t15-,18+,19-,20+,22+,23-/m1/s1 |
| InChIKey | DUPCJNAKWYCFIZ-IIVJCCGLSA-N |
| XLogP | 3.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|