About dimethyl-[(5,6,6-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)methyl]azanium
dimethyl-[(5,6,6-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)methyl]azanium (PubChem CID 4263674) has the molecular formula C13H24NO+
and a molecular weight of 210.34 g/mol. Its IUPAC name is dimethyl-[(5,6,6-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)methyl]azanium.
Molecular Properties
| Compound Name | dimethyl-[(5,6,6-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)methyl]azanium |
| PubChem CID | 4263674 |
| Molecular Formula | C13H24NO+ |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.19 |
| IUPAC Name | dimethyl-[(5,6,6-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)methyl]azanium |
| SMILES | CC1C2CC(C(C[NH+](C)C)C2=O)C1(C)C |
| InChI | InChI=1S/C13H23NO/c1-8-9-6-11(13(8,2)3)10(12(9)15)7-14(4)5/h8-11H,6-7H2,1-5H3/p+1 |
| InChIKey | IORDCIHONMRMKU-UHFFFAOYSA-O |
| XLogP | 0.63 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dimethyl-[(5,6,6-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)methyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[(5,6,6-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)methyl]azanium?
The IUPAC name of dimethyl-[(5,6,6-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)methyl]azanium (CID 4263674) is dimethyl-[(5,6,6-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)methyl]azanium.
What is the SMILES notation for dimethyl-[(5,6,6-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)methyl]azanium?
The canonical SMILES for dimethyl-[(5,6,6-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)methyl]azanium is CC1C2CC(C(C[NH+](C)C)C2=O)C1(C)C.
What is the InChIKey of dimethyl-[(5,6,6-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)methyl]azanium?
The InChIKey is IORDCIHONMRMKU-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H23NO/c1-8-9-6-11(13(8,2)3)10(12(9)15)7-14(4)5/h8-11H,6-7H2,1-5H3/p+1.
What are the key properties of dimethyl-[(5,6,6-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)methyl]azanium?
dimethyl-[(5,6,6-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)methyl]azanium has a molecular weight of 210.34 g/mol, XLogP of 0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[(5,6,6-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)methyl]azanium is sourced from PubChem (CID 4263674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).