About 4-[[3-[3-(aminomethyl)-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]benzamide
4-[[3-[3-(aminomethyl)-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]benzamide (PubChem CID 42637133) has the molecular formula C18H16N6O2
and a molecular weight of 348.37 g/mol. Its IUPAC name is 4-[[3-[3-(aminomethyl)-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]benzamide.
Molecular Properties
| Compound Name | 4-[[3-[3-(aminomethyl)-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]benzamide |
| PubChem CID | 42637133 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 4-[[3-[3-(aminomethyl)-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]benzamide |
| SMILES | NCc1noc(-c2nn(Cc3ccc(C(N)=O)cc3)c3ccccc23)n1 |
| InChI | InChI=1S/C18H16N6O2/c19-9-15-21-18(26-23-15)16-13-3-1-2-4-14(13)24(22-16)10-11-5-7-12(8-6-11)17(20)25/h1-8H,9-10,19H2,(H2,20,25) |
| InChIKey | IHYQRYPGRLFBNX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 125.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[3-[3-(aminomethyl)-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-[3-(aminomethyl)-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]benzamide?
The IUPAC name of 4-[[3-[3-(aminomethyl)-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]benzamide (CID 42637133) is 4-[[3-[3-(aminomethyl)-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]benzamide.
What is the SMILES notation for 4-[[3-[3-(aminomethyl)-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]benzamide?
The canonical SMILES for 4-[[3-[3-(aminomethyl)-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]benzamide is NCc1noc(-c2nn(Cc3ccc(C(N)=O)cc3)c3ccccc23)n1.
What is the InChIKey of 4-[[3-[3-(aminomethyl)-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]benzamide?
The InChIKey is IHYQRYPGRLFBNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N6O2/c19-9-15-21-18(26-23-15)16-13-3-1-2-4-14(13)24(22-16)10-11-5-7-12(8-6-11)17(20)25/h1-8H,9-10,19H2,(H2,20,25).
What are the key properties of 4-[[3-[3-(aminomethyl)-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]benzamide?
4-[[3-[3-(aminomethyl)-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]benzamide has a molecular weight of 348.37 g/mol, XLogP of 1.69, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-[3-(aminomethyl)-1,2,4-oxadiazol-5-yl]indazol-1-yl]methyl]benzamide is sourced from PubChem (CID 42637133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).