About 2-chloro-5-methylindolo[2,3-b]quinoline
2-chloro-5-methylindolo[2,3-b]quinoline (PubChem CID 42637230) has the molecular formula C16H11ClN2
and a molecular weight of 266.73 g/mol. Its IUPAC name is 2-chloro-5-methylindolo[2,3-b]quinoline.
Molecular Properties
| Compound Name | 2-chloro-5-methylindolo[2,3-b]quinoline |
| PubChem CID | 42637230 |
| Molecular Formula | C16H11ClN2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-chloro-5-methylindolo[2,3-b]quinoline |
| SMILES | Cn1c2nc3ccccc3c-2cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H11ClN2/c1-19-15-7-6-11(17)8-10(15)9-13-12-4-2-3-5-14(12)18-16(13)19/h2-9H,1H3 |
| InChIKey | PPGAGAYKWZKFCB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-5-methylindolo[2,3-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-methylindolo[2,3-b]quinoline?
The IUPAC name of 2-chloro-5-methylindolo[2,3-b]quinoline (CID 42637230) is 2-chloro-5-methylindolo[2,3-b]quinoline.
What is the SMILES notation for 2-chloro-5-methylindolo[2,3-b]quinoline?
The canonical SMILES for 2-chloro-5-methylindolo[2,3-b]quinoline is Cn1c2nc3ccccc3c-2cc2cc(Cl)ccc21.
What is the InChIKey of 2-chloro-5-methylindolo[2,3-b]quinoline?
The InChIKey is PPGAGAYKWZKFCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClN2/c1-19-15-7-6-11(17)8-10(15)9-13-12-4-2-3-5-14(12)18-16(13)19/h2-9H,1H3.
What are the key properties of 2-chloro-5-methylindolo[2,3-b]quinoline?
2-chloro-5-methylindolo[2,3-b]quinoline has a molecular weight of 266.73 g/mol, XLogP of 4.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-methylindolo[2,3-b]quinoline is sourced from PubChem (CID 42637230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).