About tert-butyl N-[[5-[2-(2-phenylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate
tert-butyl N-[[5-[2-(2-phenylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate (PubChem CID 42637278) has the molecular formula C23H25N5O3
and a molecular weight of 419.49 g/mol. Its IUPAC name is tert-butyl N-[[5-[2-(2-phenylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[5-[2-(2-phenylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate |
| PubChem CID | 42637278 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | tert-butyl N-[[5-[2-(2-phenylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1noc(-c2c3ccccc3nn2CCc2ccccc2)n1 |
| InChI | InChI=1S/C23H25N5O3/c1-23(2,3)30-22(29)24-15-19-25-21(31-27-19)20-17-11-7-8-12-18(17)26-28(20)14-13-16-9-5-4-6-10-16/h4-12H,13-15H2,1-3H3,(H,24,29) |
| InChIKey | XPXCLNUYAWJOPK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl N-[[5-[2-(2-phenylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[5-[2-(2-phenylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate?
The IUPAC name of tert-butyl N-[[5-[2-(2-phenylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate (CID 42637278) is tert-butyl N-[[5-[2-(2-phenylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate.
What is the SMILES notation for tert-butyl N-[[5-[2-(2-phenylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate?
The canonical SMILES for tert-butyl N-[[5-[2-(2-phenylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate is CC(C)(C)OC(=O)NCc1noc(-c2c3ccccc3nn2CCc2ccccc2)n1.
What is the InChIKey of tert-butyl N-[[5-[2-(2-phenylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate?
The InChIKey is XPXCLNUYAWJOPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N5O3/c1-23(2,3)30-22(29)24-15-19-25-21(31-27-19)20-17-11-7-8-12-18(17)26-28(20)14-13-16-9-5-4-6-10-16/h4-12H,13-15H2,1-3H3,(H,24,29).
What are the key properties of tert-butyl N-[[5-[2-(2-phenylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate?
tert-butyl N-[[5-[2-(2-phenylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate has a molecular weight of 419.49 g/mol, XLogP of 4.35, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[5-[2-(2-phenylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate is sourced from PubChem (CID 42637278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).