C19H21N3O3S — CID 42637306
ethyl 4-[4-(2-amino-4-oxo-3H-thieno[2,3-d]pyrimidin-6-yl)butyl]benzoate (PubChem CID 42637306) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is ethyl 4-[4-(2-amino-4-oxo-3H-thieno[2,3-d]pyrimidin-6-yl)butyl]benzoate.
| Compound Name | ethyl 4-[4-(2-amino-4-oxo-3H-thieno[2,3-d]pyrimidin-6-yl)butyl]benzoate |
|---|---|
| PubChem CID | 42637306 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | ethyl 4-[4-(2-amino-4-oxo-3H-thieno[2,3-d]pyrimidin-6-yl)butyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CCCCc2cc3c(=O)[nH]c(N)nc3s2)cc1 |
| InChI | InChI=1S/C19H21N3O3S/c1-2-25-18(24)13-9-7-12(8-10-13)5-3-4-6-14-11-15-16(23)21-19(20)22-17(15)26-14/h7-11H,2-6H2,1H3,(H3,20,21,22,23) |
| InChIKey | VGFNHEWHERTHBD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|