C22H20F3N5O3 — CID 42637500
tert-butyl N-[[5-[1-[(2,3,5-trifluorophenyl)methyl]indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate (PubChem CID 42637500) has the molecular formula C22H20F3N5O3 and a molecular weight of 459.43 g/mol. Its IUPAC name is tert-butyl N-[[5-[1-[(2,3,5-trifluorophenyl)methyl]indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-[1-[(2,3,5-trifluorophenyl)methyl]indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 42637500 |
| Molecular Formula | C22H20F3N5O3 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | tert-butyl N-[[5-[1-[(2,3,5-trifluorophenyl)methyl]indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1noc(-c2nn(Cc3cc(F)cc(F)c3F)c3ccccc23)n1 |
| InChI | InChI=1S/C22H20F3N5O3/c1-22(2,3)32-21(31)26-10-17-27-20(33-29-17)19-14-6-4-5-7-16(14)30(28-19)11-12-8-13(23)9-15(24)18(12)25/h4-9H,10-11H2,1-3H3,(H,26,31) |
| InChIKey | OFERJHSZSKKEEL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|