C37H49N4O8P — CID 42637857
[(2S,3S,5S)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-5-[[(2S)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanoyl]amino]-1,6-diphenylhexan-3-yl] dihydrogen phosphate (PubChem CID 42637857) has the molecular formula C37H49N4O8P and a molecular weight of 708.79 g/mol. Its IUPAC name is [(2S,3S,5S)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-5-[[(2S)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanoyl]amino]-1,6-diphenylhexan-3-yl] dihydrogen phosphate.
| Compound Name | [(2S,3S,5S)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-5-[[(2S)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanoyl]amino]-1,6-diphenylhexan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 42637857 |
| Molecular Formula | C37H49N4O8P |
| Molecular Weight | 708.79 g/mol |
| Exact Mass | 708.33 |
| IUPAC Name | [(2S,3S,5S)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-5-[[(2S)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanoyl]amino]-1,6-diphenylhexan-3-yl] dihydrogen phosphate |
| SMILES | Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@H](C[C@H](Cc1ccccc1)NC(=O)[C@H](C(C)C)N1CCCNC1=O)OP(=O)(O)O |
| InChI | InChI=1S/C37H49N4O8P/c1-25(2)34(41-20-12-19-38-37(41)44)36(43)39-30(21-28-15-7-5-8-16-28)23-32(49-50(45,46)47)31(22-29-17-9-6-10-18-29)40-33(42)24-48-35-26(3)13-11-14-27(35)4/h5-11,13-18,25,30-32,34H,12,19-24H2,1-4H3,(H,38,44)(H,39,43)(H,40,42)(H2,45,46,47)/t30-,31-,32-,34-/m0/s1 |
| InChIKey | CNHYGYLSWATBQY-SUGCFTRWSA-N |
| XLogP | 4.45 |
| TPSA | 166.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.79 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|