C18H15N5O3 — CID 42637998
5-[6-amino-9-(2-phenylethyl)purin-8-yl]furan-2-carboxylic acid (PubChem CID 42637998) has the molecular formula C18H15N5O3 and a molecular weight of 349.35 g/mol. Its IUPAC name is 5-[6-amino-9-(2-phenylethyl)purin-8-yl]furan-2-carboxylic acid.
| Compound Name | 5-[6-amino-9-(2-phenylethyl)purin-8-yl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 42637998 |
| Molecular Formula | C18H15N5O3 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 5-[6-amino-9-(2-phenylethyl)purin-8-yl]furan-2-carboxylic acid |
| SMILES | Nc1ncnc2c1nc(-c1ccc(C(=O)O)o1)n2CCc1ccccc1 |
| InChI | InChI=1S/C18H15N5O3/c19-15-14-17(21-10-20-15)23(9-8-11-4-2-1-3-5-11)16(22-14)12-6-7-13(26-12)18(24)25/h1-7,10H,8-9H2,(H,24,25)(H2,19,20,21) |
| InChIKey | XLIHMYPVGJXNDG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |