About 3,8-dibromoacenaphthylene
3,8-dibromoacenaphthylene (PubChem CID 42638690) has the molecular formula C12H6Br2
and a molecular weight of 309.99 g/mol. Its IUPAC name is 3,8-dibromoacenaphthylene.
Molecular Properties
| Compound Name | 3,8-dibromoacenaphthylene |
| PubChem CID | 42638690 |
| Molecular Formula | C12H6Br2 |
| Molecular Weight | 309.99 g/mol |
| Exact Mass | 307.88 |
| IUPAC Name | 3,8-dibromoacenaphthylene |
| SMILES | Brc1ccc2ccc(Br)c3c2c1C=C3 |
| InChI | InChI=1S/C12H6Br2/c13-10-5-1-7-2-6-11(14)9-4-3-8(10)12(7)9/h1-6H |
| InChIKey | HJCPYGFGIYJFGN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.99 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,8-dibromoacenaphthylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dibromoacenaphthylene?
The IUPAC name of 3,8-dibromoacenaphthylene (CID 42638690) is 3,8-dibromoacenaphthylene.
What is the SMILES notation for 3,8-dibromoacenaphthylene?
The canonical SMILES for 3,8-dibromoacenaphthylene is Brc1ccc2ccc(Br)c3c2c1C=C3.
What is the InChIKey of 3,8-dibromoacenaphthylene?
The InChIKey is HJCPYGFGIYJFGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Br2/c13-10-5-1-7-2-6-11(14)9-4-3-8(10)12(7)9/h1-6H.
What are the key properties of 3,8-dibromoacenaphthylene?
3,8-dibromoacenaphthylene has a molecular weight of 309.99 g/mol, XLogP of 4.85, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dibromoacenaphthylene is sourced from PubChem (CID 42638690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).