C25H24F2O6 — CID 42638878
(7S,14R)-7,14-bis(4-fluorophenyl)-11,11-dimethyl-1,4,10,12-tetraoxadispiro[4.2.58.25]pentadecane-9,13-dione (PubChem CID 42638878) has the molecular formula C25H24F2O6 and a molecular weight of 458.46 g/mol. Its IUPAC name is (7S,14R)-7,14-bis(4-fluorophenyl)-11,11-dimethyl-1,4,10,12-tetraoxadispiro[4.2.58.25]pentadecane-9,13-dione.
| Compound Name | (7S,14R)-7,14-bis(4-fluorophenyl)-11,11-dimethyl-1,4,10,12-tetraoxadispiro[4.2.58.25]pentadecane-9,13-dione |
|---|---|
| PubChem CID | 42638878 |
| Molecular Formula | C25H24F2O6 |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | (7S,14R)-7,14-bis(4-fluorophenyl)-11,11-dimethyl-1,4,10,12-tetraoxadispiro[4.2.58.25]pentadecane-9,13-dione |
| SMILES | CC1(C)OC(=O)C2(C(=O)O1)[C@@H](c1ccc(F)cc1)CC1(C[C@H]2c2ccc(F)cc2)OCCO1 |
| InChI | InChI=1S/C25H24F2O6/c1-23(2)32-21(28)25(22(29)33-23)19(15-3-7-17(26)8-4-15)13-24(30-11-12-31-24)14-20(25)16-5-9-18(27)10-6-16/h3-10,19-20H,11-14H2,1-2H3/t19-,20+ |
| InChIKey | BUDWFRFVSCEAAM-BGYRXZFFSA-N |
| XLogP | 4.19 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|