C15H24O2 — CID 42638975
(3R,3aR,8aS)-3-(2-hydroxypropan-2-yl)-8a-methyl-2,3,3a,4,7,8-hexahydro-1H-azulene-6-carbaldehyde (PubChem CID 42638975) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (3R,3aR,8aS)-3-(2-hydroxypropan-2-yl)-8a-methyl-2,3,3a,4,7,8-hexahydro-1H-azulene-6-carbaldehyde.
| Compound Name | (3R,3aR,8aS)-3-(2-hydroxypropan-2-yl)-8a-methyl-2,3,3a,4,7,8-hexahydro-1H-azulene-6-carbaldehyde |
|---|---|
| PubChem CID | 42638975 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (3R,3aR,8aS)-3-(2-hydroxypropan-2-yl)-8a-methyl-2,3,3a,4,7,8-hexahydro-1H-azulene-6-carbaldehyde |
| SMILES | CC(C)(O)[C@@H]1CC[C@@]2(C)CCC(C=O)=CC[C@H]12 |
| InChI | InChI=1S/C15H24O2/c1-14(2,17)12-7-9-15(3)8-6-11(10-16)4-5-13(12)15/h4,10,12-13,17H,5-9H2,1-3H3/t12-,13-,15-/m1/s1 |
| InChIKey | AHLZXJMYBAUIEQ-UMVBOHGHSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|