C16H18BF3N2O2 — CID 42639219
1-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazole (PubChem CID 42639219) has the molecular formula C16H18BF3N2O2 and a molecular weight of 338.14 g/mol. Its IUPAC name is 1-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazole.
| Compound Name | 1-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 42639219 |
| Molecular Formula | C16H18BF3N2O2 |
| Molecular Weight | 338.14 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)pyrazole |
| SMILES | CC1(C)OB(c2cc(C(F)(F)F)nn2-c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C16H18BF3N2O2/c1-14(2)15(3,4)24-17(23-14)13-10-12(16(18,19)20)21-22(13)11-8-6-5-7-9-11/h5-10H,1-4H3 |
| InChIKey | BAMSBXUHXZYKLW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.14 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|