C14H13Cl2N3O — CID 4263937
4-(3,4-dichlorophenyl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepin-2-one (PubChem CID 4263937) has the molecular formula C14H13Cl2N3O and a molecular weight of 310.18 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepin-2-one.
| Compound Name | 4-(3,4-dichlorophenyl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepin-2-one |
|---|---|
| PubChem CID | 4263937 |
| Molecular Formula | C14H13Cl2N3O |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepin-2-one |
| SMILES | O=c1nc2c(c(-c3ccc(Cl)c(Cl)c3)[nH]1)CCCCN2 |
| InChI | InChI=1S/C14H13Cl2N3O/c15-10-5-4-8(7-11(10)16)12-9-3-1-2-6-17-13(9)19-14(20)18-12/h4-5,7H,1-3,6H2,(H2,17,18,19,20) |
| InChIKey | ILUAFGACNQEIOH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |