C14H16N2O2 — CID 42639503
(6R,6aS,8E)-8-ethylidene-6-hydroxy-6,6a,7,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 42639503) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is (6R,6aS,8E)-8-ethylidene-6-hydroxy-6,6a,7,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6R,6aS,8E)-8-ethylidene-6-hydroxy-6,6a,7,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 42639503 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (6R,6aS,8E)-8-ethylidene-6-hydroxy-6,6a,7,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | C/C=C1\C[C@H]2[C@@H](O)Nc3ccccc3C(=O)N2C1 |
| InChI | InChI=1S/C14H16N2O2/c1-2-9-7-12-13(17)15-11-6-4-3-5-10(11)14(18)16(12)8-9/h2-6,12-13,15,17H,7-8H2,1H3/b9-2+/t12-,13+/m0/s1 |
| InChIKey | ULQQQQMOGBDJEB-PHVGEZJSSA-N |
| XLogP | 1.59 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|