C24H28O6S2 — CID 42639671
[(2R,3S,5R)-3,5-diacetyloxy-6,6-bis(phenylsulfanyl)hexan-2-yl] acetate (PubChem CID 42639671) has the molecular formula C24H28O6S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is [(2R,3S,5R)-3,5-diacetyloxy-6,6-bis(phenylsulfanyl)hexan-2-yl] acetate.
| Compound Name | [(2R,3S,5R)-3,5-diacetyloxy-6,6-bis(phenylsulfanyl)hexan-2-yl] acetate |
|---|---|
| PubChem CID | 42639671 |
| Molecular Formula | C24H28O6S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | [(2R,3S,5R)-3,5-diacetyloxy-6,6-bis(phenylsulfanyl)hexan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C[C@@H](OC(C)=O)C(Sc1ccccc1)Sc1ccccc1)[C@@H](C)OC(C)=O |
| InChI | InChI=1S/C24H28O6S2/c1-16(28-17(2)25)22(29-18(3)26)15-23(30-19(4)27)24(31-20-11-7-5-8-12-20)32-21-13-9-6-10-14-21/h5-14,16,22-24H,15H2,1-4H3/t16-,22+,23-/m1/s1 |
| InChIKey | YOTPYYKQJRAIBZ-UZFJHSOTSA-N |
| XLogP | 5.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|