About 4,5-diphenylthieno[2,3-c]pyran-7-one
4,5-diphenylthieno[2,3-c]pyran-7-one (PubChem CID 42639703) has the molecular formula C19H12O2S
and a molecular weight of 304.37 g/mol. Its IUPAC name is 4,5-diphenylthieno[2,3-c]pyran-7-one.
Molecular Properties
| Compound Name | 4,5-diphenylthieno[2,3-c]pyran-7-one |
| PubChem CID | 42639703 |
| Molecular Formula | C19H12O2S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 4,5-diphenylthieno[2,3-c]pyran-7-one |
| SMILES | O=c1oc(-c2ccccc2)c(-c2ccccc2)c2ccsc12 |
| InChI | InChI=1S/C19H12O2S/c20-19-18-15(11-12-22-18)16(13-7-3-1-4-8-13)17(21-19)14-9-5-2-6-10-14/h1-12H |
| InChIKey | YUNMQZIHAOLFBH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-diphenylthieno[2,3-c]pyran-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diphenylthieno[2,3-c]pyran-7-one?
The IUPAC name of 4,5-diphenylthieno[2,3-c]pyran-7-one (CID 42639703) is 4,5-diphenylthieno[2,3-c]pyran-7-one.
What is the SMILES notation for 4,5-diphenylthieno[2,3-c]pyran-7-one?
The canonical SMILES for 4,5-diphenylthieno[2,3-c]pyran-7-one is O=c1oc(-c2ccccc2)c(-c2ccccc2)c2ccsc12.
What is the InChIKey of 4,5-diphenylthieno[2,3-c]pyran-7-one?
The InChIKey is YUNMQZIHAOLFBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12O2S/c20-19-18-15(11-12-22-18)16(13-7-3-1-4-8-13)17(21-19)14-9-5-2-6-10-14/h1-12H.
What are the key properties of 4,5-diphenylthieno[2,3-c]pyran-7-one?
4,5-diphenylthieno[2,3-c]pyran-7-one has a molecular weight of 304.37 g/mol, XLogP of 5.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diphenylthieno[2,3-c]pyran-7-one is sourced from PubChem (CID 42639703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).