About N-(2-carbamoylphenyl)-2-(3-fluoro-4-methoxyphenyl)-1,3-thiazole-4-carboxamide
N-(2-carbamoylphenyl)-2-(3-fluoro-4-methoxyphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 42639780) has the molecular formula C18H14FN3O3S
and a molecular weight of 371.39 g/mol. Its IUPAC name is N-(2-carbamoylphenyl)-2-(3-fluoro-4-methoxyphenyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-carbamoylphenyl)-2-(3-fluoro-4-methoxyphenyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 42639780 |
| Molecular Formula | C18H14FN3O3S |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-(2-carbamoylphenyl)-2-(3-fluoro-4-methoxyphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(-c2nc(C(=O)Nc3ccccc3C(N)=O)cs2)cc1F |
| InChI | InChI=1S/C18H14FN3O3S/c1-25-15-7-6-10(8-12(15)19)18-22-14(9-26-18)17(24)21-13-5-3-2-4-11(13)16(20)23/h2-9H,1H3,(H2,20,23)(H,21,24) |
| InChIKey | WZUFYWZKBJKBPG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-carbamoylphenyl)-2-(3-fluoro-4-methoxyphenyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-carbamoylphenyl)-2-(3-fluoro-4-methoxyphenyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of N-(2-carbamoylphenyl)-2-(3-fluoro-4-methoxyphenyl)-1,3-thiazole-4-carboxamide (CID 42639780) is N-(2-carbamoylphenyl)-2-(3-fluoro-4-methoxyphenyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-(2-carbamoylphenyl)-2-(3-fluoro-4-methoxyphenyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-(2-carbamoylphenyl)-2-(3-fluoro-4-methoxyphenyl)-1,3-thiazole-4-carboxamide is COc1ccc(-c2nc(C(=O)Nc3ccccc3C(N)=O)cs2)cc1F.
What is the InChIKey of N-(2-carbamoylphenyl)-2-(3-fluoro-4-methoxyphenyl)-1,3-thiazole-4-carboxamide?
The InChIKey is WZUFYWZKBJKBPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14FN3O3S/c1-25-15-7-6-10(8-12(15)19)18-22-14(9-26-18)17(24)21-13-5-3-2-4-11(13)16(20)23/h2-9H,1H3,(H2,20,23)(H,21,24).
What are the key properties of N-(2-carbamoylphenyl)-2-(3-fluoro-4-methoxyphenyl)-1,3-thiazole-4-carboxamide?
N-(2-carbamoylphenyl)-2-(3-fluoro-4-methoxyphenyl)-1,3-thiazole-4-carboxamide has a molecular weight of 371.39 g/mol, XLogP of 3.31, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-carbamoylphenyl)-2-(3-fluoro-4-methoxyphenyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 42639780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).