C26H25F3N6O — CID 42639958
(11R,15S)-5-anilino-8-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),4,9-trien-7-one (PubChem CID 42639958) has the molecular formula C26H25F3N6O and a molecular weight of 494.52 g/mol. Its IUPAC name is (11R,15S)-5-anilino-8-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),4,9-trien-7-one.
| Compound Name | (11R,15S)-5-anilino-8-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),4,9-trien-7-one |
|---|---|
| PubChem CID | 42639958 |
| Molecular Formula | C26H25F3N6O |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | (11R,15S)-5-anilino-8-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),4,9-trien-7-one |
| SMILES | CN1C(=O)c2c(Nc3ccccc3)nn(CCc3ccc(C(F)(F)F)cc3)c2N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C26H25F3N6O/c1-33-24(36)21-22(30-18-6-3-2-4-7-18)32-34(15-14-16-10-12-17(13-11-16)26(27,28)29)23(21)35-20-9-5-8-19(20)31-25(33)35/h2-4,6-7,10-13,19-20H,5,8-9,14-15H2,1H3,(H,30,32)/t19-,20+/m1/s1 |
| InChIKey | AOVWAEBACUADBF-UXHICEINSA-N |
| XLogP | 5.07 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |