C19H14F3N9 — CID 42640102
6-[2-[[6-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[3,4-f][1,2,4]triazin-8-yl]amino]ethylamino]pyridine-3-carbonitrile (PubChem CID 42640102) has the molecular formula C19H14F3N9 and a molecular weight of 425.38 g/mol. Its IUPAC name is 6-[2-[[6-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[3,4-f][1,2,4]triazin-8-yl]amino]ethylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[2-[[6-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[3,4-f][1,2,4]triazin-8-yl]amino]ethylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 42640102 |
| Molecular Formula | C19H14F3N9 |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 6-[2-[[6-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[3,4-f][1,2,4]triazin-8-yl]amino]ethylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NCCNc2nc(-c3ccc(C(F)(F)F)cc3)nn3cnnc23)nc1 |
| InChI | InChI=1S/C19H14F3N9/c20-19(21,22)14-4-2-13(3-5-14)16-28-17(18-29-27-11-31(18)30-16)25-8-7-24-15-6-1-12(9-23)10-26-15/h1-6,10-11H,7-8H2,(H,24,26)(H,25,28,30) |
| InChIKey | LBRFRXHBIYBCHW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|