C28H35Cl2N3O4S — CID 42640119
2-cyclopentyl-4-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-N-methylsulfonylbenzamide;dihydrochloride (PubChem CID 42640119) has the molecular formula C28H35Cl2N3O4S and a molecular weight of 580.58 g/mol. Its IUPAC name is 2-cyclopentyl-4-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-N-methylsulfonylbenzamide;dihydrochloride.
| Compound Name | 2-cyclopentyl-4-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-N-methylsulfonylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 42640119 |
| Molecular Formula | C28H35Cl2N3O4S |
| Molecular Weight | 580.58 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | 2-cyclopentyl-4-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-N-methylsulfonylbenzamide;dihydrochloride |
| SMILES | CS(=O)(=O)NC(=O)c1ccc(-c2ccc(CCNC[C@H](O)c3cccnc3)cc2)cc1C1CCCC1.Cl.Cl |
| InChI | InChI=1S/C28H33N3O4S.2ClH/c1-36(34,35)31-28(33)25-13-12-23(17-26(25)22-5-2-3-6-22)21-10-8-20(9-11-21)14-16-30-19-27(32)24-7-4-15-29-18-24;;/h4,7-13,15,17-18,22,27,30,32H,2-3,5-6,14,16,19H2,1H3,(H,31,33);2*1H/t27-;;/m0../s1 |
| InChIKey | HJUOLAKOVUTXOO-LPCSYZHESA-N |
| XLogP | 4.80 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|