C14H24O7 — CID 42640130
(1R,2S,3S,5R,7R,8S,10S,11S)-7,10-dimethoxy-1,3-dimethyl-4,12-dioxatricyclo[6.3.1.02,7]dodecane-2,5,11-triol (PubChem CID 42640130) has the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. Its IUPAC name is (1R,2S,3S,5R,7R,8S,10S,11S)-7,10-dimethoxy-1,3-dimethyl-4,12-dioxatricyclo[6.3.1.02,7]dodecane-2,5,11-triol.
| Compound Name | (1R,2S,3S,5R,7R,8S,10S,11S)-7,10-dimethoxy-1,3-dimethyl-4,12-dioxatricyclo[6.3.1.02,7]dodecane-2,5,11-triol |
|---|---|
| PubChem CID | 42640130 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (1R,2S,3S,5R,7R,8S,10S,11S)-7,10-dimethoxy-1,3-dimethyl-4,12-dioxatricyclo[6.3.1.02,7]dodecane-2,5,11-triol |
| SMILES | CO[C@H]1C[C@@H]2O[C@](C)([C@H]1O)[C@@]1(O)[C@H](C)O[C@@H](O)C[C@@]21OC |
| InChI | InChI=1S/C14H24O7/c1-7-14(17)12(2)11(16)8(18-3)5-9(21-12)13(14,19-4)6-10(15)20-7/h7-11,15-17H,5-6H2,1-4H3/t7-,8-,9-,10+,11-,12+,13+,14-/m0/s1 |
| InChIKey | VOXRJYWWINZCOZ-DEHUOKPOSA-N |
| XLogP | -0.83 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |