C20H18N2O2 — CID 42640422
4-methoxy-N-[4-(2-methyl-4-pyridinyl)phenyl]benzamide (PubChem CID 42640422) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 4-methoxy-N-[4-(2-methyl-4-pyridinyl)phenyl]benzamide.
| Compound Name | 4-methoxy-N-[4-(2-methyl-4-pyridinyl)phenyl]benzamide |
|---|---|
| PubChem CID | 42640422 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 4-methoxy-N-[4-(2-methyl-4-pyridinyl)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(-c3ccnc(C)c3)cc2)cc1 |
| InChI | InChI=1S/C20H18N2O2/c1-14-13-17(11-12-21-14)15-3-7-18(8-4-15)22-20(23)16-5-9-19(24-2)10-6-16/h3-13H,1-2H3,(H,22,23) |
| InChIKey | RZLHTNZOJKFINY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |