C32H42F3NO8 — CID 42640474
[(1S,2S,4S,5S,6S,7R,8S)-8-[[(E)-dodec-2-enoyl]amino]-1-hydroxy-5-methoxy-10-oxo-3-oxatricyclo[4.3.1.02,4]decan-7-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 42640474) has the molecular formula C32H42F3NO8 and a molecular weight of 625.68 g/mol. Its IUPAC name is [(1S,2S,4S,5S,6S,7R,8S)-8-[[(E)-dodec-2-enoyl]amino]-1-hydroxy-5-methoxy-10-oxo-3-oxatricyclo[4.3.1.02,4]decan-7-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S,2S,4S,5S,6S,7R,8S)-8-[[(E)-dodec-2-enoyl]amino]-1-hydroxy-5-methoxy-10-oxo-3-oxatricyclo[4.3.1.02,4]decan-7-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 42640474 |
| Molecular Formula | C32H42F3NO8 |
| Molecular Weight | 625.68 g/mol |
| Exact Mass | 625.29 |
| IUPAC Name | [(1S,2S,4S,5S,6S,7R,8S)-8-[[(E)-dodec-2-enoyl]amino]-1-hydroxy-5-methoxy-10-oxo-3-oxatricyclo[4.3.1.02,4]decan-7-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CCCCCCCCC/C=C/C(=O)N[C@H]1C[C@@]2(O)C(=O)[C@H]([C@H](OC)[C@@H]3O[C@@H]32)[C@H]1OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C32H42F3NO8/c1-4-5-6-7-8-9-10-11-15-18-22(37)36-21-19-30(40)27(38)23(25(41-2)26-28(30)43-26)24(21)44-29(39)31(42-3,32(33,34)35)20-16-13-12-14-17-20/h12-18,21,23-26,28,40H,4-11,19H2,1-3H3,(H,36,37)/b18-15+/t21-,23-,24-,25-,26-,28-,30+,31+/m0/s1 |
| InChIKey | NYWCANKFIZJTQW-PLFFHANUSA-N |
| XLogP | 4.30 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.68 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|