C16H15ClO5 — CID 42640492
dimethyl (1S,3aR,9bS)-8-chloro-1,3a,4,9b-tetrahydrocyclopenta[c]chromene-1,3-dicarboxylate (PubChem CID 42640492) has the molecular formula C16H15ClO5 and a molecular weight of 322.74 g/mol. Its IUPAC name is dimethyl (1S,3aR,9bS)-8-chloro-1,3a,4,9b-tetrahydrocyclopenta[c]chromene-1,3-dicarboxylate.
| Compound Name | dimethyl (1S,3aR,9bS)-8-chloro-1,3a,4,9b-tetrahydrocyclopenta[c]chromene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 42640492 |
| Molecular Formula | C16H15ClO5 |
| Molecular Weight | 322.74 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | dimethyl (1S,3aR,9bS)-8-chloro-1,3a,4,9b-tetrahydrocyclopenta[c]chromene-1,3-dicarboxylate |
| SMILES | COC(=O)C1=C[C@H](C(=O)OC)[C@H]2c3cc(Cl)ccc3OC[C@@H]12 |
| InChI | InChI=1S/C16H15ClO5/c1-20-15(18)9-6-11(16(19)21-2)14-10-5-8(17)3-4-13(10)22-7-12(9)14/h3-6,11-12,14H,7H2,1-2H3/t11-,12-,14+/m0/s1 |
| InChIKey | VLTGRWPUTLSICI-SGMGOOAPSA-N |
| XLogP | 2.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.74 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |