C29H25BrFN7O2 — CID 42640622
(11R,15S)-4-[bromo-[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-5-(2-hydroxyanilino)-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 42640622) has the molecular formula C29H25BrFN7O2 and a molecular weight of 602.47 g/mol. Its IUPAC name is (11R,15S)-4-[bromo-[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-5-(2-hydroxyanilino)-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | (11R,15S)-4-[bromo-[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-5-(2-hydroxyanilino)-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 42640622 |
| Molecular Formula | C29H25BrFN7O2 |
| Molecular Weight | 602.47 g/mol |
| Exact Mass | 601.12 |
| IUPAC Name | (11R,15S)-4-[bromo-[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-5-(2-hydroxyanilino)-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(C(Br)c3ccc(-c4cccc(F)n4)cc3)c2Nc2ccccc2O)N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C29H25BrFN7O2/c1-36-28(40)24-26(33-20-6-2-3-10-22(20)39)38(35-27(24)37-21-9-4-8-19(21)34-29(36)37)25(30)17-14-12-16(13-15-17)18-7-5-11-23(31)32-18/h2-3,5-7,10-15,19,21,25,33,39H,4,8-9H2,1H3/t19-,21+,25?/m1/s1 |
| InChIKey | BFTKNLXUTDUFLY-NHJXTLMQSA-N |
| XLogP | 5.66 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|